| Name |
(4-Methoxy-4-oxobutyl) triphenylphosphonium bromide
|
| Molecular Formula |
C23H24BrO2P
|
| Molecular Weight |
443.3
|
| Smiles |
COC(=O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]
|
COC(=O)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.