| Name |
ethyl 2-(8-(2-methoxyethyl)-1,7-dimethyl-2,4-dioxo-1H-imidazo[2,1-f]purin-3(2H,4H,8H)-yl)acetate
|
| Molecular Formula |
C16H21N5O5
|
| Molecular Weight |
363.37
|
| Smiles |
CCOC(=O)Cn1c(=O)c2c(nc3n(CCOC)c(C)cn23)n(C)c1=O
|
CCOC(=O)Cn1c(=O)c2c(nc3n(CCOC)c(C)cn23)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.