| Name |
2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole
|
| Molecular Formula |
C9H5Cl3N2O
|
| Molecular Weight |
263.5
|
| Smiles |
ClCc1nnc(-c2cc(Cl)ccc2Cl)o1
|
ClCc1nnc(-c2cc(Cl)ccc2Cl)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.