| Name |
N-(1-butyl-2-oxo-1,2,3,4-tetrahydroquinolin-6-yl)-2-(4-fluorophenyl)acetamide
|
| Molecular Formula |
C21H23FN2O2
|
| Molecular Weight |
354.4
|
| Smiles |
CCCCN1C(=O)CCc2cc(NC(=O)Cc3ccc(F)cc3)ccc21
|
CCCCN1C(=O)CCc2cc(NC(=O)Cc3ccc(F)cc3)ccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.