| Name |
8-(2,5-Dimethoxyphenyl)-3-(3-hydroxypropyl)-1,6,7-trimethyl-1,3,5-trihydro-4-i midazolino[1,2-h]purine-2,4-dione
|
| Molecular Formula |
C21H25N5O5
|
| Molecular Weight |
427.5
|
| Smiles |
COc1ccc(OC)c(-n2c(C)c(C)n3c4c(=O)n(CCCO)c(=O)n(C)c4nc23)c1
|
COc1ccc(OC)c(-n2c(C)c(C)n3c4c(=O)n(CCCO)c(=O)n(C)c4nc23)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.