| Name |
3-[(1S)-2-[(1S,3S,5S)-3-Cyano-2-azabicyclo[3.1.0]hex-2-yl]-2-oxo-1-[(2,2,2-trifluoroacetyl)amino]ethyl]tricyclo[3.3.1.13,7]dec-1-yl 2,2,2-trifluoroacetate
|
| Molecular Formula |
C22H23F6N3O4
|
| Molecular Weight |
507.4
|
| Smiles |
N#CC1CC2CC2N1C(=O)C(NC(=O)C(F)(F)F)C12CC3CC(CC(OC(=O)C(F)(F)F)(C3)C1)C2
|
N#CC1CC2CC2N1C(=O)C(NC(=O)C(F)(F)F)C12CC3CC(CC(OC(=O)C(F)(F)F)(C3)C1)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.