| Name |
3-Bromo-4',5-difluoro-1,1'-biphenyl
|
| Molecular Formula |
C12H7BrF2
|
| Molecular Weight |
269.08
|
| Smiles |
Fc1ccc(-c2cc(F)cc(Br)c2)cc1
|
Fc1ccc(-c2cc(F)cc(Br)c2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.