| Name |
N-{2-[(3-chlorophenyl)carbamoyl]-1-benzofuran-3-yl}-5-phenyl-1,2-oxazole-3-carboxamide
|
| Molecular Formula |
C25H16ClN3O4
|
| Molecular Weight |
457.9
|
| Smiles |
O=C(Nc1c(C(=O)Nc2cccc(Cl)c2)oc2ccccc12)c1cc(-c2ccccc2)on1
|
O=C(Nc1c(C(=O)Nc2cccc(Cl)c2)oc2ccccc12)c1cc(-c2ccccc2)on1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.