| Name |
5-Fluoro-2,3-dihydro-7-nitro-1,4-benzodioxin
|
| Molecular Formula |
C8H6FNO4
|
| Molecular Weight |
199.14
|
| Smiles |
O=[N+]([O-])c1cc(F)c2c(c1)OCCO2
|
O=[N+]([O-])c1cc(F)c2c(c1)OCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.