| Name |
N-Boc-2(S)-2-amino-3-{1-[(2,4,6-trimethylphenyl)sulfonyl]-1H-indol-3-yl}propanal
|
| Molecular Formula |
C25H30N2O5S
|
| Molecular Weight |
470.6
|
| Smiles |
Cc1cc(C)c(S(=O)(=O)n2cc(CC(C=O)NC(=O)OC(C)(C)C)c3ccccc32)c(C)c1
|
Cc1cc(C)c(S(=O)(=O)n2cc(CC(C=O)NC(=O)OC(C)(C)C)c3ccccc32)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.