| Name |
[(3aS,5S,6aR,8S,9R,9aR,9bR)-8-acetyloxy-5-hydroxy-3,6-dimethylidene-2-oxo-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[8,7-b]furan-9-yl]methyl acetate
|
| Molecular Formula |
C19H24O7
|
| Molecular Weight |
364.4
|
| Smiles |
C=C1C(=O)OC2C1CC(O)C(=C)C1CC(OC(C)=O)C(COC(C)=O)C12
|
C=C1C(=O)OC2C1CC(O)C(=C)C1CC(OC(C)=O)C(COC(C)=O)C12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.