| Name |
5-[(4,7-Dimethoxy-1,3-benzodioxol-5-yl)methyl]-4,5-dihydro-1,2-oxazole-3-carbohydrazide
|
| Molecular Formula |
C14H17N3O6
|
| Molecular Weight |
323.30
|
| Smiles |
COc1cc(CC2CC(C(=O)NN)=NO2)c(OC)c2c1OCO2
|
COc1cc(CC2CC(C(=O)NN)=NO2)c(OC)c2c1OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.