| Name |
2-{6-ethyl-4-oxo-3H,4H-thieno[2,3-d]pyrimidin-2-yl}acetonitrile
|
| Molecular Formula |
C10H9N3OS
|
| Molecular Weight |
219.27
|
| Smiles |
CCc1cc2c(=O)[nH]c(CC#N)nc2s1
|
CCc1cc2c(=O)[nH]c(CC#N)nc2s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.