| Name |
[4-[3-(3-Chlorophenyl)-1,2,4-oxadiazol-5-yl]-1,3-thiazolidin-3-yl]-(5-methylthiophen-2-yl)methanone
|
| Molecular Formula |
C17H14ClN3O2S2
|
| Molecular Weight |
391.9
|
| Smiles |
Cc1ccc(C(=O)N2CSCC2c2nc(-c3cccc(Cl)c3)no2)s1
|
Cc1ccc(C(=O)N2CSCC2c2nc(-c3cccc(Cl)c3)no2)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.