| Name |
(3S,7R,8S,9S,10R,13R,14S,17R)-17-[(2S,3R,5R)-3-hydroxy-5,6-dimethylheptan-2-yl]-7-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
|
| Molecular Formula |
C29H50O3
|
| Molecular Weight |
446.7
|
| Smiles |
COC1C=C2CC(O)CCC2(C)C2CCC3(C)C(C(C)C(O)CC(C)C(C)C)CCC3C12
|
COC1C=C2CC(O)CCC2(C)C2CCC3(C)C(C(C)C(O)CC(C)C(C)C)CCC3C12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.