| Name |
10-Chloro-1,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one
|
| Molecular Formula |
C13H6ClN3O
|
| Molecular Weight |
255.66
|
| Smiles |
O=c1c2ccccc2n2nnc3ccc(Cl)c1c32
|
O=c1c2ccccc2n2nnc3ccc(Cl)c1c32
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.