| Name |
(11S,12R,16S)-11-(4-chlorobenzoyl)-14-(4-nitrophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione
|
| Molecular Formula |
C26H17ClN4O5
|
| Molecular Weight |
500.9
|
| Smiles |
O=C(c1ccc(Cl)cc1)C1C2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C2C2c3ccccc3C=NN12
|
O=C(c1ccc(Cl)cc1)C1C2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C2C2c3ccccc3C=NN12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.