| Name |
(2Z)-2-(1,3-benzothiazol-2-yl)-3-{3-[4-(ethylsulfanyl)phenyl]-1-phenyl-1H-pyrazol-4-yl}prop-2-enenitrile
|
| Molecular Formula |
C27H20N4S2
|
| Molecular Weight |
464.6
|
| Smiles |
CCSc1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)c2nc3ccccc3s2)cc1
|
CCSc1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)c2nc3ccccc3s2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.