| Name |
1-[4-(2-phenylethenesulfonyl)piperazin-1-yl]-2-({1-[(thiophen-2-yl)methyl]-1H-1,2,3,4-tetrazol-5-yl}sulfanyl)ethan-1-one
|
| Molecular Formula |
C20H22N6O3S3
|
| Molecular Weight |
490.6
|
| Smiles |
O=C(CSc1nnnn1Cc1cccs1)N1CCN(S(=O)(=O)C=Cc2ccccc2)CC1
|
O=C(CSc1nnnn1Cc1cccs1)N1CCN(S(=O)(=O)C=Cc2ccccc2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.