| Name |
5-(4-Aminophenyl)-2,4-dihydro-4-propyl-3H-1,2,4-triazole-3-thione
|
| Molecular Formula |
C11H14N4S
|
| Molecular Weight |
234.32
|
| Smiles |
CCCn1c(-c2ccc(N)cc2)n[nH]c1=S
|
CCCn1c(-c2ccc(N)cc2)n[nH]c1=S
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.