| Name |
1-(2-(Thiophen-2-yl)-1,10b-dihydrospiro[benzo[e]pyrazolo[1,5-c][1,3]oxazine-5,4'-piperidin]-1'-yl)ethanone
|
| Molecular Formula |
C20H21N3O2S
|
| Molecular Weight |
367.5
|
| Smiles |
CC(=O)N1CCC2(CC1)Oc1ccccc1C1CC(c3cccs3)=NN12
|
CC(=O)N1CCC2(CC1)Oc1ccccc1C1CC(c3cccs3)=NN12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.