| Name |
2-{[4-cyclopropyl-5-(pyridin-4-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-{2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl}acetamide
|
| Molecular Formula |
C20H23N7O3S
|
| Molecular Weight |
441.5
|
| Smiles |
O=C(CSc1nnc(-c2ccncc2)n1C1CC1)NN1C(=O)NC2(CCCCC2)C1=O
|
O=C(CSc1nnc(-c2ccncc2)n1C1CC1)NN1C(=O)NC2(CCCCC2)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.