| Name |
2-[(4,5-dimethyl-4H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide
|
| Molecular Formula |
C10H13N5OS2
|
| Molecular Weight |
283.4
|
| Smiles |
Cc1csc(NC(=O)CSc2nnc(C)n2C)n1
|
Cc1csc(NC(=O)CSc2nnc(C)n2C)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.