| Name |
2-[(4-chlorobenzyl)sulfanyl]-1-(4-chlorophenyl)-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole 5,5-dioxide
|
| Molecular Formula |
C18H16Cl2N2O2S2
|
| Molecular Weight |
427.4
|
| Smiles |
O=S1(=O)CC2N=C(SCc3ccc(Cl)cc3)N(c3ccc(Cl)cc3)C2C1
|
O=S1(=O)CC2N=C(SCc3ccc(Cl)cc3)N(c3ccc(Cl)cc3)C2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.