| Name |
3-(3,4-dimethoxyphenyl)-9-(1,1-dioxidotetrahydrothiophen-3-yl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-2(8H)-one
|
| Molecular Formula |
C23H23NO7S
|
| Molecular Weight |
457.5
|
| Smiles |
COc1ccc(-c2cc3ccc4c(c3oc2=O)CN(C2CCS(=O)(=O)C2)CO4)cc1OC
|
COc1ccc(-c2cc3ccc4c(c3oc2=O)CN(C2CCS(=O)(=O)C2)CO4)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.