| Name |
(Z)-8-(furan-2-ylmethyl)-2-(thiophen-2-ylmethylene)-8,9-dihydro-2H-benzofuro[7,6-e][1,3]oxazin-3(7H)-one
|
| Molecular Formula |
C20H15NO4S
|
| Molecular Weight |
365.4
|
| Smiles |
O=C1C(=Cc2cccs2)Oc2c1ccc1c2CN(Cc2ccco2)CO1
|
O=C1C(=Cc2cccs2)Oc2c1ccc1c2CN(Cc2ccco2)CO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.