| Name |
tert-Butyl 4-methyl-3,6-dihydro-2H-1,2-oxazine-2-carboxylate
|
| Molecular Formula |
C10H17NO3
|
| Molecular Weight |
199.25
|
| Smiles |
CC1=CCON(C(=O)OC(C)(C)C)C1
|
CC1=CCON(C(=O)OC(C)(C)C)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.