| Name |
1-benzyl-4-{1H-pyrazolo[3,4-d]pyrimidin-4-yl}piperazine
|
| Molecular Formula |
C16H18N6
|
| Molecular Weight |
294.35
|
| Smiles |
c1ccc(CN2CCN(c3ncnc4[nH]ncc34)CC2)cc1
|
c1ccc(CN2CCN(c3ncnc4[nH]ncc34)CC2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.