| Name |
ethyl 4-(2-hydroxy-3-(((1S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl)oxy)propyl)piperazine-1-carboxylate hydrochloride
|
| Molecular Formula |
C20H37ClN2O4
|
| Molecular Weight |
405.0
|
| Smiles |
CCOC(=O)N1CCN(CC(O)COC2CC3CCC2(C)C3(C)C)CC1.Cl
|
CCOC(=O)N1CCN(CC(O)COC2CC3CCC2(C)C3(C)C)CC1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.