| Name |
N,N'-(Oxybis(ethane-2,1-diyl))bis(2,4-dinitroaniline)
|
| Molecular Formula |
C16H16N6O9
|
| Molecular Weight |
436.33
|
| Smiles |
O=[N+]([O-])c1ccc(NCCOCCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1
|
O=[N+]([O-])c1ccc(NCCOCCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.