| Name |
8-Oxa-4-thia-3,5,6-triazadecanoic acid, 9,9-dimethyl-7-oxo-, 4,4-dioxide
|
| Molecular Formula |
C7H15N3O6S
|
| Molecular Weight |
269.28
|
| Smiles |
CC(C)(C)OC(=O)NNS(=O)(=O)NCC(=O)O
|
CC(C)(C)OC(=O)NNS(=O)(=O)NCC(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.