| Name |
2-(2-(2-(4,4-Dimethyl-4,5-dihydrooxazol-2-yl)naphthalen-1-yl)phenyl)-4,4-Dimethyl-4,5-dihydrooxazole
|
| Molecular Formula |
C26H26N2O2
|
| Molecular Weight |
398.5
|
| Smiles |
CC1(C)COC(c2ccccc2-c2c(C3=NC(C)(C)CO3)ccc3ccccc23)=N1
|
CC1(C)COC(c2ccccc2-c2c(C3=NC(C)(C)CO3)ccc3ccccc23)=N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.