| Name |
I+/--D-Glucopyranose, 4,6-O-ethylidene-1,2-O-(phenylmethylene)-
|
| Molecular Formula |
C15H18O6
|
| Molecular Weight |
294.30
|
| Smiles |
CC1OCC2OC3OC(c4ccccc4)OC3C(O)C2O1
|
CC1OCC2OC3OC(c4ccccc4)OC3C(O)C2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.