| Name |
N1-(2,2-dimethoxyethyl)-N2-(5,5-dioxido-2-phenyl-4,6-dihydro-2H-thieno[3,4-c]pyrazol-3-yl)oxalamide
|
| Molecular Formula |
C17H20N4O6S
|
| Molecular Weight |
408.4
|
| Smiles |
COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1)CS(=O)(=O)C2)OC
|
COC(CNC(=O)C(=O)Nc1c2c(nn1-c1ccccc1)CS(=O)(=O)C2)OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.