| Name |
N-methyl-N-{[1-(prop-2-en-1-yl)-1H-benzimidazol-2-yl]methyl}furan-2-carboxamide
|
| Molecular Formula |
C17H17N3O2
|
| Molecular Weight |
295.34
|
| Smiles |
C=CCn1c(CN(C)C(=O)c2ccco2)nc2ccccc21
|
C=CCn1c(CN(C)C(=O)c2ccco2)nc2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.