| Name |
1,3-dibenzyl-4',4',6',8'-tetramethyl-4'H-spiro[imidazolidine-2,1'-pyrrolo[3,2,1-ij]quinolin]-2'-one
|
| Molecular Formula |
C31H33N3O
|
| Molecular Weight |
463.6
|
| Smiles |
CC1=CC(C)(C)N2C(=O)C3(c4cc(C)cc1c42)N(Cc1ccccc1)CCN3Cc1ccccc1
|
CC1=CC(C)(C)N2C(=O)C3(c4cc(C)cc1c42)N(Cc1ccccc1)CCN3Cc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.