| Name |
8,9,10-Trimethoxy-6-oxo-6H-dibenzo[b,d]pyran-3-yl 2-([1,1a(2)-biphenyl]-4-yloxy)acetate
|
| Molecular Formula |
C30H24O8
|
| Molecular Weight |
512.5
|
| Smiles |
COc1cc2c(=O)oc3cc(OC(=O)COc4ccc(-c5ccccc5)cc4)ccc3c2c(OC)c1OC
|
COc1cc2c(=O)oc3cc(OC(=O)COc4ccc(-c5ccccc5)cc4)ccc3c2c(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.