| Name |
2-{2-[(2-{[3-Cyano-6-phenyl-4-(trifluoromethyl)-2-pyridinyl]sulfanyl}acetyl)amino]-1,3-thiazol-4-yl}-2-(methoxyimino)acetic acid
|
| Molecular Formula |
C21H14F3N5O4S2
|
| Molecular Weight |
521.5
|
| Smiles |
CON=C(C(=O)O)c1csc(NC(=O)CSc2nc(-c3ccccc3)cc(C(F)(F)F)c2C#N)n1
|
CON=C(C(=O)O)c1csc(NC(=O)CSc2nc(-c3ccccc3)cc(C(F)(F)F)c2C#N)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.