| Name |
(22e)-Ergosta-8,22-diene-3beta,5alpha,6beta,7alpha-tetrol
|
| Molecular Formula |
C28H46O4
|
| Molecular Weight |
446.7
|
| Smiles |
CC(C)C(C)C=CC(C)C1CCC2C3=C(CCC21C)C1(C)CCC(O)CC1(O)C(O)C3O
|
CC(C)C(C)C=CC(C)C1CCC2C3=C(CCC21C)C1(C)CCC(O)CC1(O)C(O)C3O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.