| Name |
1,2,3-Propanetriol, 1-(4-hydroxy-3,5-dimethoxyphenyl)-, (1R,2R)-rel-
|
| Molecular Formula |
C11H16O6
|
| Molecular Weight |
244.24
|
| Smiles |
COc1cc(C(O)C(O)CO)cc(OC)c1O
|
COc1cc(C(O)C(O)CO)cc(OC)c1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.