| Name |
Glucopyranoside, 3-T-butyl phenyl
|
| Molecular Formula |
C16H24O6
|
| Molecular Weight |
312.36
|
| Smiles |
CC(C)(C)c1cccc(OC2OC(CO)C(O)C(O)C2O)c1
|
CC(C)(C)c1cccc(OC2OC(CO)C(O)C(O)C2O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.