| Name |
Ethyl 3-[8-(4-ethylphenyl)-1,7-dimethyl-2,4-dioxo-1,3,5-trihydro-4-imidazolino [1,2-h]purin-3-yl]propanoate
|
| Molecular Formula |
C22H25N5O4
|
| Molecular Weight |
423.5
|
| Smiles |
CCOC(=O)CCn1c(=O)c2c(nc3n(-c4ccc(CC)cc4)c(C)cn23)n(C)c1=O
|
CCOC(=O)CCn1c(=O)c2c(nc3n(-c4ccc(CC)cc4)c(C)cn23)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.