| Name |
2-{[5-(3,4-dimethoxyphenyl)-4-ethyl-4H-1,2,4-triazol-3-yl]sulfanyl}acetohydrazide
|
| Molecular Formula |
C14H19N5O3S
|
| Molecular Weight |
337.40
|
| Smiles |
CCn1c(SCC(=O)NN)nnc1-c1ccc(OC)c(OC)c1
|
CCn1c(SCC(=O)NN)nnc1-c1ccc(OC)c(OC)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.