| Name |
4,4-Dimethyl[1,4a(2)-bipiperidine]-2,6-dione
|
| Molecular Formula |
C12H20N2O2
|
| Molecular Weight |
224.30
|
| Smiles |
CC1(C)CC(=O)N(C2CCNCC2)C(=O)C1
|
CC1(C)CC(=O)N(C2CCNCC2)C(=O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.