| Name |
[[(2R,3S,4R,5R)-5-[5-[3-[(2-aminooxyacetyl)amino]prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate
|
| Molecular Formula |
C14H21N4O17P3
|
| Molecular Weight |
610.25
|
| Smiles |
NOCC(=O)NCC#Cc1cn(C2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C2O)c(=O)[nH]c1=O
|
NOCC(=O)NCC#Cc1cn(C2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C2O)c(=O)[nH]c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.