| Name |
ethyl 2-[(1E)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-ylidene]acetate
|
| Molecular Formula |
C15H18O3
|
| Molecular Weight |
246.30
|
| Smiles |
CCOC(=O)C=C1CCCc2c(OC)cccc21
|
CCOC(=O)C=C1CCCc2c(OC)cccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.