| Name |
2-{[3-(2-Methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino}benzoic acid
|
| Molecular Formula |
C14H16N2O4S
|
| Molecular Weight |
308.35
|
| Smiles |
CC(C)CN1C(=O)SC(Nc2ccccc2C(=O)O)C1=O
|
CC(C)CN1C(=O)SC(Nc2ccccc2C(=O)O)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.