| Name |
8-Chloro-6-(2-chlorophenyl)-6-methoxy-1-methyl-4H,6H-[1,2,4]triazolo[4,3-a][4,1]benzoxazepine
|
| Molecular Formula |
C18H15Cl2N3O2
|
| Molecular Weight |
376.2
|
| Smiles |
COC1(c2ccccc2Cl)OCc2nnc(C)n2-c2ccc(Cl)cc21
|
COC1(c2ccccc2Cl)OCc2nnc(C)n2-c2ccc(Cl)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.