| Name |
1-methyl-3-(2-oxopropyl)-9-phenyl-6,7,8,9-tetrahydropyrimido[2,1-f]purine-2,4(1H,3H)-dione
|
| Molecular Formula |
C18H19N5O3
|
| Molecular Weight |
353.4
|
| Smiles |
CC(=O)Cn1c(=O)c2c(nc3n2CCCN3c2ccccc2)n(C)c1=O
|
CC(=O)Cn1c(=O)c2c(nc3n2CCCN3c2ccccc2)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.