| Name |
4-imino-3,5,6-triphenyl-1H,2H,3H,4H-furo[2,3-d]pyrimidine-2-thione
|
| Molecular Formula |
C24H17N3OS
|
| Molecular Weight |
395.5
|
| Smiles |
Nc1c2c(-c3ccccc3)c(-c3ccccc3)oc2nc(=S)n1-c1ccccc1
|
Nc1c2c(-c3ccccc3)c(-c3ccccc3)oc2nc(=S)n1-c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.